cas: 1192547-87-7 — see every product listed under this CAS number, including other names
Methyl 4-chloro-3,5-dimethylbenzoate, 98% (CAS 1192547-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A905102-1g |
| cas | 1192547-87-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 258.79 Pln | |
| AmBeed | 250mg | 226.24 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 169.75 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-chloro-3,5-dimethylbenzoate (CAS 1192547-87-7) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: methyl 4-chloro-3,5-dimethylbenzoate. InChIKey: YLDCLGVDBHWQBX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | methyl 4-chloro-3,5-dimethylbenzoate |
| InChIKey | YLDCLGVDBHWQBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)C(=O)OC |
Computed by PubChem (NCBI)