cas: 6214-20-6 — see every product listed under this CAS number, including other names
Methyl 4-Nitrobenzenesulfonate, >98.0%(HPLC)(GC) (CAS 6214-20-6) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3576-200MG |
| cas | 6214-20-6 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 162.60 Pln | |
| TCI | 1g | 506.81 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(GC) |
Methyl 4-nitrobenzenesulfonate (CAS 6214-20-6) is a chemical compound with the molecular formula C7H7NO5S and a molecular weight of 217.20 g/mol. IUPAC name: methyl 4-nitrobenzenesulfonate. InChIKey: RMNJNEUWTBBZPT-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5S |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | methyl 4-nitrobenzenesulfonate |
| InChIKey | RMNJNEUWTBBZPT-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)