cas: 6214-20-6 — see every product listed under this CAS number, including other names
Methyl 4-nitrobenzene-1-sulfonate, 95% (CAS 6214-20-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F245865-250MG |
| cas | 6214-20-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 2.5g | 476.93 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1356.83 Pln | |
| Fluorochem | 25g | 2762.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-nitrobenzenesulfonate (CAS 6214-20-6) is a chemical compound with the molecular formula C7H7NO5S and a molecular weight of 217.20 g/mol. IUPAC name: methyl 4-nitrobenzenesulfonate. InChIKey: RMNJNEUWTBBZPT-UHFFFAOYSA-N.
| Molecular formula | C7H7NO5S |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | methyl 4-nitrobenzenesulfonate |
| InChIKey | RMNJNEUWTBBZPT-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)