CAS 98545-64-3 appears in our catalog under these names: Methyl 4–amino–2–bromobenzoate, Methyl 4-amino-2-bromobenzoate, 95%, 95%, Methyl 4-amino-2-bromobenzoate, 97%, Methyl 4-amino-2-bromobenzoate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 50g, 500g.
Methyl 4-amino-2-bromobenzoate (CAS 98545-64-3) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 4-amino-2-bromobenzoate. InChIKey: KZOQVTUWEHNNMH-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 4-amino-2-bromobenzoate |
| InChIKey | KZOQVTUWEHNNMH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)Br |
Computed by PubChem (NCBI)