cas: 863886-04-8 — see every product listed under this CAS number, including other names
Methyl 4-amino-3-chloro-5-nitrobenzoate 98% (CAS 863886-04-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A504863-250mg |
| cas | 863886-04-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 292.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A504863 |
Methyl 4-amino-3-chloro-5-nitrobenzoate (CAS 863886-04-8) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: methyl 4-amino-3-chloro-5-nitrobenzoate. InChIKey: ZJFONSIKILEGMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | methyl 4-amino-3-chloro-5-nitrobenzoate |
| InChIKey | ZJFONSIKILEGMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)