cas: 850544-21-7 — see every product listed under this CAS number, including other names
Methyl 4-amino-5-nitropicolinate 97% (CAS 850544-21-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A855061-100mg |
| cas | 850544-21-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 754.19 Pln | |
| Ambeed | 1g | 1532.94 Pln | |
| Ambeed | 5g | 5387.75 Pln | |
| Ambeed | 10g | 8575.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A855061 |
Methyl 4-amino-5-nitropyridine-2-carboxylate (CAS 850544-21-7) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: methyl 4-amino-5-nitropyridine-2-carboxylate. InChIKey: UNPOGSAFUSHRDJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | methyl 4-amino-5-nitropyridine-2-carboxylate |
| InChIKey | UNPOGSAFUSHRDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)