CAS 5910-19-0 appears in our catalog under these names: N-Methyl-2,6-dinitroaniline, 98%, N-Methyl-2,6-dinitroaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
N-methyl-2,6-dinitroaniline (CAS 5910-19-0) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: N-methyl-2,6-dinitroaniline. InChIKey: YEYQXUWULBDKHV-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | N-methyl-2,6-dinitroaniline |
| InChIKey | YEYQXUWULBDKHV-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC=C1[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)