cas: 850544-21-7 — see every product listed under this CAS number, including other names
2-Pyridinecarboxylicacid, 4-amino-5-nitro-, methyl ester, 97%, 97% (CAS 850544-21-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147FZ-100mg |
| cas | 850544-21-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 500mg | 981.20 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 5g | 4139.60 Pln | |
| Chemat | 10g | 6582.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-amino-5-nitropyridine-2-carboxylate (CAS 850544-21-7) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: methyl 4-amino-5-nitropyridine-2-carboxylate. InChIKey: UNPOGSAFUSHRDJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | methyl 4-amino-5-nitropyridine-2-carboxylate |
| InChIKey | UNPOGSAFUSHRDJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)