Methyl 4-bromo-2-fluoro-6-iodobenzoate, 97%
cas: 1935413-12-9 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-fluoro-6-iodobenzoate, 97% (CAS 1935413-12-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A572844-100mg |
| cas | 1935413-12-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2829.00 Pln | |
| Ambeed | 5g | 8347.00 Pln | |
| BLDpharm | 100mg | 719.77 Pln | |
| BLDpharm | 250mg | 1169.61 Pln | |
| BLDpharm | 1g | 3041.18 Pln | |
| BLDpharm | 5g | 8994.64 Pln | |
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 2066.00 Pln | |
| Chemat | 5g | 6078.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-bromo-2-fluoro-6-iodobenzoate (CAS 1935413-12-9) is a chemical compound with the molecular formula C8H5BrFIO2 and a molecular weight of 358.93 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-6-iodobenzoate. InChIKey: CAYGCAXDBJTWQL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFIO2 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-6-iodobenzoate |
| InChIKey | CAYGCAXDBJTWQL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1I)Br)F |
Computed by PubChem (NCBI)
