Methyl 4-bromo-3-isopropylbenzoate, 95%
cas: 2169639-98-7 — see every product listed under this CAS number, including other names
Methyl 4-bromo-3-isopropylbenzoate, 95% (CAS 2169639-98-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A697346-100mg |
| cas | 2169639-98-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1527.38 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 1641.67 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1245.20 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 2309.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-bromo-3-propan-2-ylbenzoate (CAS 2169639-98-7) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: methyl 4-bromo-3-propan-2-ylbenzoate. InChIKey: KGPUVQSKTNZKSD-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | methyl 4-bromo-3-propan-2-ylbenzoate |
| InChIKey | KGPUVQSKTNZKSD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)