cas: 1256789-39-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-6-methoxypicolinate, 97% (CAS 1256789-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690671-100MG |
| cas | 1256789-39-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 1g | 2153.43 Pln | |
| Fluorochem | 5g | 5032.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-bromo-6-methoxypyridine-2-carboxylate (CAS 1256789-39-5) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: methyl 4-bromo-6-methoxypyridine-2-carboxylate. InChIKey: AAWIADLBEITCEV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | methyl 4-bromo-6-methoxypyridine-2-carboxylate |
| InChIKey | AAWIADLBEITCEV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=N1)C(=O)OC)Br |
Computed by PubChem (NCBI)