cas: 1351668-30-8 — see every product listed under this CAS number, including other names
Methyl 4-ethoxy-2,6-difluorobenzoate, ≥95%, ≥95% (CAS 1351668-30-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K6CR-1g |
| cas | 1351668-30-8 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1307.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-ethoxy-2,6-difluorobenzoate (CAS 1351668-30-8) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: methyl 4-ethoxy-2,6-difluorobenzoate. InChIKey: WNVNQECCLYIUKW-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | methyl 4-ethoxy-2,6-difluorobenzoate |
| InChIKey | WNVNQECCLYIUKW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)