cas: 1351668-30-8 — see every product listed under this CAS number, including other names
Methyl 4-ethoxy-2,6-difluorobenzoate, 97% (CAS 1351668-30-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A935815-25g |
| cas | 1351668-30-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 34514.41 Pln | |
| AmBeed | 10g | 17588.41 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-ethoxy-2,6-difluorobenzoate (CAS 1351668-30-8) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: methyl 4-ethoxy-2,6-difluorobenzoate. InChIKey: WNVNQECCLYIUKW-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | methyl 4-ethoxy-2,6-difluorobenzoate |
| InChIKey | WNVNQECCLYIUKW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)