CAS 1351668-30-8 appears in our catalog under these names: Methyl 2,6-difluoro-4-ethoxybenxoate, 95%, Methyl 4-ethoxy-2,6-difluorobenzoate, 97%, Methyl 4-ethoxy-2,6-difluorobenzoate, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 4-ethoxy-2,6-difluorobenzoate (CAS 1351668-30-8) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: methyl 4-ethoxy-2,6-difluorobenzoate. InChIKey: WNVNQECCLYIUKW-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | methyl 4-ethoxy-2,6-difluorobenzoate |
| InChIKey | WNVNQECCLYIUKW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)