Methyl 4-formyl-3-methylbenzoate 98%
cas: 24078-24-8 — see every product listed under this CAS number, including other names
Methyl 4-formyl-3-methylbenzoate 98% (CAS 24078-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A651908-100mg |
| cas | 24078-24-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 10g | 3001.44 Pln | |
| Ambeed | 25g | 5938.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A651908 |
Methyl 4-formyl-3-methylbenzoate (CAS 24078-24-8) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 4-formyl-3-methylbenzoate. InChIKey: BNDZGHTWTJZPSE-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 4-formyl-3-methylbenzoate |
| InChIKey | BNDZGHTWTJZPSE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)C=O |
Computed by PubChem (NCBI)