cas: 72922-61-3 — see every product listed under this CAS number, including other names
Methyl 4-nitro-1h-indazole-6-carboxylate, 95% (CAS 72922-61-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 500mg, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-4677-250mg |
| cas | 72922-61-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 500mg | 128.10 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1632.78 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 500mg | 128.10 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 4-nitro-1H-indazole-6-carboxylate (CAS 72922-61-3) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 4-nitro-1H-indazole-6-carboxylate. InChIKey: OIJKWHSNBQFGHC-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 4-nitro-1H-indazole-6-carboxylate |
| InChIKey | OIJKWHSNBQFGHC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=NN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)