cas: 163213-38-5 — see every product listed under this CAS number, including other names
Methyl 4-oxo-5,6,7,8-tetrahydro-4H-pyrazolo(1,5-a)(1,4)diazepine-2-carboxylate, 98+% (CAS 163213-38-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A614078-10g |
| cas | 163213-38-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13994.89 Pln | |
| AmBeed | 100mg | 1000.93 Pln | |
| AmBeed | 5g | 11579.68 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate (CAS 163213-38-5) is a chemical compound with the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate. InChIKey: VWXQPZYUOQXYLQ-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxylate |
| InChIKey | VWXQPZYUOQXYLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN2CCCNC(=O)C2=C1 |
Computed by PubChem (NCBI)