CAS 173731-96-9 appears in our catalog under these names: 4-Guanidino-2-methoxybenzoic acid, 95%, 4–Guanidino–2–methoxybenzoic acid, 4-Guanidino-2-methoxybenzoic acid, 99%, 99%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(diaminomethylideneamino)-2-methoxybenzoic acid (CAS 173731-96-9) is a chemical compound with the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. IUPAC name: 4-(diaminomethylideneamino)-2-methoxybenzoic acid. InChIKey: GYYCWERYJWNAKZ-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-(diaminomethylideneamino)-2-methoxybenzoic acid |
| InChIKey | GYYCWERYJWNAKZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N=C(N)N)C(=O)O |
Computed by PubChem (NCBI)