CAS 36894-29-8 appears in our catalog under these names: 3,3-Dimethyl-1-(2-nitrophenyl)urea, 95%, 3,3-Dimethyl-1-(2-nitrophenyl)urea. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,1-dimethyl-3-(2-nitrophenyl)urea (CAS 36894-29-8) is a chemical compound with the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. IUPAC name: 1,1-dimethyl-3-(2-nitrophenyl)urea. InChIKey: FRBHCWIPAUJHEP-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O3 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1,1-dimethyl-3-(2-nitrophenyl)urea |
| InChIKey | FRBHCWIPAUJHEP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)