cas: 30611-21-3 — see every product listed under this CAS number, including other names
Methyl 4-pentanoylbenzoate 98% (CAS 30611-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A269078-100mg |
| cas | 30611-21-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A269078 |
Methyl 4-pentanoylbenzoate (CAS 30611-21-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 4-pentanoylbenzoate. InChIKey: LSDGSJYZSOPREL-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 4-pentanoylbenzoate |
| InChIKey | LSDGSJYZSOPREL-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)