cas: 745078-74-4 — see every product listed under this CAS number, including other names
Methyl 5-(3-bromophenyl)isoxazole-3-carboxylate 97% (CAS 745078-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128612-100mg |
| cas | 745078-74-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 448.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A128612 |
Methyl 5-(3-bromophenyl)-1,2-oxazole-3-carboxylate (CAS 745078-74-4) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 5-(3-bromophenyl)-1,2-oxazole-3-carboxylate. InChIKey: CMRCBZBHVKPEIX-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 5-(3-bromophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | CMRCBZBHVKPEIX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)