cas: 1610705-51-5 — see every product listed under this CAS number, including other names
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate, 98%, 98% (CAS 1610705-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VMD-100mg |
| cas | 1610705-51-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 827.60 Pln | |
| Chemat | 25g | 3328.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate (CAS 1610705-51-5) is a chemical compound with the molecular formula C12H17BN2O4 and a molecular weight of 264.09 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate. InChIKey: OMKFGJOPZQLNCN-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O4 |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
| InChIKey | OMKFGJOPZQLNCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(=O)OC |
Computed by PubChem (NCBI)