cas: 16475-90-4 — see every product listed under this CAS number, including other names
Methyl 5-Acetyl-2-hydroxybenzoate, 98% (CAS 16475-90-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066798-10G |
| cas | 16475-90-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 320.74 Pln | |
| Fluorochem | 500g | 1268.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-acetyl-2-hydroxybenzoate (CAS 16475-90-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl 5-acetyl-2-hydroxybenzoate. InChIKey: XLSMGNNWSRNTIQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl 5-acetyl-2-hydroxybenzoate |
| InChIKey | XLSMGNNWSRNTIQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)O)C(=O)OC |
Computed by PubChem (NCBI)