cas: 292070-01-0 — see every product listed under this CAS number, including other names
Methyl 5-amino-1H-benzo(d)imidazole-2-carboxylate, 95% (CAS 292070-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A728525-1g |
| cas | 292070-01-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10733.38 Pln | |
| AmBeed | 10g | 45854.83 Pln | |
| AmBeed | 5g | 30959.95 Pln | |
| AmBeed | 100mg | 3709.09 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 6-amino-1H-benzimidazole-2-carboxylate (CAS 292070-01-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 6-amino-1H-benzimidazole-2-carboxylate. InChIKey: KPLHXWFXDADDMP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 6-amino-1H-benzimidazole-2-carboxylate |
| InChIKey | KPLHXWFXDADDMP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(N1)C=C(C=C2)N |
Computed by PubChem (NCBI)