cas: 151793-18-9 — see every product listed under this CAS number, including other names
Methyl 5-amino-4-fluoro-2-methoxybenzoate, 95%, 95% (CAS 151793-18-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANYB-100mg |
| cas | 151793-18-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1854.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-amino-4-fluoro-2-methoxybenzoate (CAS 151793-18-9) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: methyl 5-amino-4-fluoro-2-methoxybenzoate. InChIKey: CUSKEOYJJXBWGW-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | methyl 5-amino-4-fluoro-2-methoxybenzoate |
| InChIKey | CUSKEOYJJXBWGW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)N)F |
Computed by PubChem (NCBI)