cas: 1820612-76-7 — see every product listed under this CAS number, including other names
Methyl 5-bromo-3-chloro-6-hydroxypyridine-2-carboxylate, 97%, 97% (CAS 1820612-76-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1IL-1g |
| cas | 1820612-76-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 7024.40 Pln | |
| Chemat | 25g | 13989.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-3-chloro-6-oxo-1H-pyridine-2-carboxylate (CAS 1820612-76-7) is a chemical compound with the molecular formula C7H5BrClNO3 and a molecular weight of 266.47 g/mol. IUPAC name: methyl 5-bromo-3-chloro-6-oxo-1H-pyridine-2-carboxylate. InChIKey: ULSMCUBUZZOFMC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO3 |
|---|---|
| Molecular weight | 266.47 g/mol |
| IUPAC name | methyl 5-bromo-3-chloro-6-oxo-1H-pyridine-2-carboxylate |
| InChIKey | ULSMCUBUZZOFMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=O)N1)Br)Cl |
Computed by PubChem (NCBI)