cas: 1688685-61-1 — see every product listed under this CAS number, including other names
Methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate 95% (CAS 1688685-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A813551-100mg |
| cas | 1688685-61-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2400.69 Pln | |
| Ambeed | 250mg | 4392.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A813551 |
Methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate (CAS 1688685-61-1) is a chemical compound with the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. IUPAC name: methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate. InChIKey: HIYPYTSNHTXCOD-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O2 |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | methyl 5-chloro-6-(trifluoromethyl)pyrazine-2-carboxylate |
| InChIKey | HIYPYTSNHTXCOD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C(=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)