CAS 1260891-67-5 is the registry number for Methyl 2-chloro-6-(trifluoromethyl)pyrimidine-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-6-(trifluoromethyl)pyrimidine-4-carboxylate (CAS 1260891-67-5) is a chemical compound with the molecular formula C7H4ClF3N2O2 and a molecular weight of 240.57 g/mol. IUPAC name: methyl 2-chloro-6-(trifluoromethyl)pyrimidine-4-carboxylate. InChIKey: BBTSSLJEJKGNCC-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N2O2 |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | methyl 2-chloro-6-(trifluoromethyl)pyrimidine-4-carboxylate |
| InChIKey | BBTSSLJEJKGNCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=N1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)