cas: 952479-97-9 — see every product listed under this CAS number, including other names
Methyl 5-fluoro-3-methyl-2-nitrobenzoate, 98% (CAS 952479-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339800-100MG |
| cas | 952479-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 500mg | 966.34 Pln | |
| Fluorochem | 1g | 1221.46 Pln | |
| Fluorochem | 2.5g | 2955.23 Pln | |
| Fluorochem | 5g | 3642.49 Pln | |
| Fluorochem | 10g | 6870.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-fluoro-3-methyl-2-nitrobenzoate (CAS 952479-97-9) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: methyl 5-fluoro-3-methyl-2-nitrobenzoate. InChIKey: VFTXULHKYAMECP-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | methyl 5-fluoro-3-methyl-2-nitrobenzoate |
| InChIKey | VFTXULHKYAMECP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C(=O)OC)F |
Computed by PubChem (NCBI)