Methyl 5-methoxy-2-nitrobenzoate, 95%
cas: 2327-45-9 — see every product listed under this CAS number, including other names
Methyl 5-methoxy-2-nitrobenzoate, 95% (CAS 2327-45-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A255925-1g |
| cas | 2327-45-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 405.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 247.72 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 5-methoxy-2-nitrobenzoate (CAS 2327-45-9) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 5-methoxy-2-nitrobenzoate. InChIKey: UAPJKEJWOPOJJY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 5-methoxy-2-nitrobenzoate |
| InChIKey | UAPJKEJWOPOJJY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)