cas: 952182-17-1 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate, 97% (CAS 952182-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F328605-100MG |
| cas | 952182-17-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1299.56 Pln | |
| Fluorochem | 5g | 3767.44 Pln | |
| Fluorochem | 10g | 6219.70 Pln | |
| Fluorochem | 25g | 11139.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-nitro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (CAS 952182-17-1) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate. InChIKey: WWCIKRATXUMSLS-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| InChIKey | WWCIKRATXUMSLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CN=C2N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)