cas: 78155-75-6 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1h-indazole-3-carboxylate, 95% (CAS 78155-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 100mg, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-8868-1g |
| cas | 78155-75-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 500mg | 466.52 Pln | |
| Fluorochem | 1g | 591.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 5-nitro-1H-indazole-3-carboxylate (CAS 78155-75-6) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-indazole-3-carboxylate. InChIKey: TUUGVBZYZYAHPC-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-indazole-3-carboxylate |
| InChIKey | TUUGVBZYZYAHPC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)