Methyl 6-(bromomethyl)-3-fluoropicolinate, 97%
cas: 1256836-16-4 — see every product listed under this CAS number, including other names
Methyl 6-(bromomethyl)-3-fluoropicolinate, 97% (CAS 1256836-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1339212-100mg |
| cas | 1256836-16-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 754.19 Pln | |
| Ambeed | 250mg | 1215.88 Pln | |
| Ambeed | 1g | 3051.50 Pln | |
| BLDpharm | 100mg | 736.43 Pln | |
| BLDpharm | 250mg | 1191.83 Pln | |
| BLDpharm | 1g | 2991.19 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 846.80 Pln | |
| Chemat | 1g | 2181.20 Pln | |
| Fluorochem | 100mg | 961.14 Pln | |
| Fluorochem | 250mg | 1575.50 Pln | |
| Fluorochem | 1g | 4038.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 6-(bromomethyl)-3-fluoropyridine-2-carboxylate (CAS 1256836-16-4) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: methyl 6-(bromomethyl)-3-fluoropyridine-2-carboxylate. InChIKey: ANYDRRQZZKTLPU-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | methyl 6-(bromomethyl)-3-fluoropyridine-2-carboxylate |
| InChIKey | ANYDRRQZZKTLPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=N1)CBr)F |
Computed by PubChem (NCBI)