cas: 73907-98-9 — see every product listed under this CAS number, including other names
Methyl 6-amino-1H-indazole-7-carboxylate, 97% (CAS 73907-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221380-100MG |
| cas | 73907-98-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 4652.55 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 4652.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-amino-1H-indazole-7-carboxylate (CAS 73907-98-9) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 6-amino-1H-indazole-7-carboxylate. InChIKey: QHEAFURFKCHXJW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 6-amino-1H-indazole-7-carboxylate |
| InChIKey | QHEAFURFKCHXJW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC2=C1NN=C2)N |
Computed by PubChem (NCBI)