cas: 944129-00-4 — see every product listed under this CAS number, including other names
Methyl 6-amino-2-chloropyrimidine-4-carboxylate, 95%, 95% (CAS 944129-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMMG-100mg |
| cas | 944129-00-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2099.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-amino-2-chloropyrimidine-4-carboxylate (CAS 944129-00-4) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 6-amino-2-chloropyrimidine-4-carboxylate. InChIKey: DZPNGOOGJKXYRF-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | methyl 6-amino-2-chloropyrimidine-4-carboxylate |
| InChIKey | DZPNGOOGJKXYRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=N1)Cl)N |
Computed by PubChem (NCBI)