cas: 1637774-20-9 — see every product listed under this CAS number, including other names
Methyl 6-amino-3-bromo-2-fluorobenzoate, 98%, 98% (CAS 1637774-20-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FR5P-50mg |
| cas | 1637774-20-9 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 352.40 Pln | |
| Chemat | 1g | 1749.20 Pln | |
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 645.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-amino-3-bromo-2-fluorobenzoate (CAS 1637774-20-9) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: methyl 6-amino-3-bromo-2-fluorobenzoate. InChIKey: PAMIUSPSZUDRMT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | methyl 6-amino-3-bromo-2-fluorobenzoate |
| InChIKey | PAMIUSPSZUDRMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)N |
Computed by PubChem (NCBI)