cas: 262586-62-9 — see every product listed under this CAS number, including other names
Methyl 6-bromo-4-oxo-1,4-dihydroquinoline-2-carboxylate, 96%, 96% (CAS 262586-62-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SHC-250mg |
| cas | 262586-62-9 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1523.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-4-oxo-1H-quinoline-2-carboxylate (CAS 262586-62-9) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 6-bromo-4-oxo-1H-quinoline-2-carboxylate. InChIKey: DUKAAWDFGPMTJT-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 6-bromo-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | DUKAAWDFGPMTJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)