cas: 425675-94-1 — see every product listed under this CAS number, including other names
Methyl 6-bromobenzofuran-2-carboxylate 95% (CAS 425675-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154572-100mg |
| cas | 425675-94-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 971.12 Pln | |
| Ambeed | 5g | 3541.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154572 |
Methyl 6-bromo-1-benzofuran-2-carboxylate (CAS 425675-94-1) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: methyl 6-bromo-1-benzofuran-2-carboxylate. InChIKey: SWFWGZFCUROKBN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | methyl 6-bromo-1-benzofuran-2-carboxylate |
| InChIKey | SWFWGZFCUROKBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C=C(C=C2)Br |
Computed by PubChem (NCBI)