cas: 1240523-96-9 — see every product listed under this CAS number, including other names
Methyl 6-bromoindoline-4-carboxylate hydrochloride, 97% (CAS 1240523-96-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A436035-10g |
| cas | 1240523-96-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 26005.84 Pln | |
| AmBeed | 5g | 15635.41 Pln | |
| AmBeed | 1g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 6-bromo-2,3-dihydro-1H-indole-4-carboxylate;hydrochloride (CAS 1240523-96-9) is a chemical compound with the molecular formula C10H11BrClNO2 and a molecular weight of 292.55 g/mol. IUPAC name: methyl 6-bromo-2,3-dihydro-1H-indole-4-carboxylate;hydrochloride. InChIKey: MBLUGEKCWMZYCM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO2 |
|---|---|
| Molecular weight | 292.55 g/mol |
| IUPAC name | methyl 6-bromo-2,3-dihydro-1H-indole-4-carboxylate;hydrochloride |
| InChIKey | MBLUGEKCWMZYCM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCNC2=CC(=C1)Br.Cl |
Computed by PubChem (NCBI)