CAS 2379322-37-7 appears in our catalog under these names: Butyl 3-bromo-2-chloroisonicotinate, 95%, Butyl 3-bromo-2-chloroisonicotinate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Butyl 3-bromo-2-chloropyridine-4-carboxylate (CAS 2379322-37-7) is a chemical compound with the molecular formula C10H11BrClNO2 and a molecular weight of 292.55 g/mol. IUPAC name: butyl 3-bromo-2-chloropyridine-4-carboxylate. InChIKey: KKWNPBCUEJVATA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO2 |
|---|---|
| Molecular weight | 292.55 g/mol |
| IUPAC name | butyl 3-bromo-2-chloropyridine-4-carboxylate |
| InChIKey | KKWNPBCUEJVATA-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=C(C(=NC=C1)Cl)Br |
Computed by PubChem (NCBI)