Products 1335055-73-6

CAS 1335055-73-6 is the registry number for 5-Bromo-2-chloro-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-2-chloropyridine-3-carboxylate (CAS 1335055-73-6) is a chemical compound with the molecular formula C10H11BrClNO2 and a molecular weight of 292.55 g/mol. IUPAC name: tert-butyl 5-bromo-2-chloropyridine-3-carboxylate. InChIKey: AKAWCXVBQHDOHY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrClNO2
Molecular weight292.55 g/mol
IUPAC nametert-butyl 5-bromo-2-chloropyridine-3-carboxylate
InChIKeyAKAWCXVBQHDOHY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)Cl

Computed by PubChem (NCBI)