cas: 915107-30-1 — see every product listed under this CAS number, including other names
Methyl 6-chloro-5-hydroxynicotinate 96% (CAS 915107-30-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119762-100mg |
| cas | 915107-30-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 1243.69 Pln | |
| Ambeed | 5g | 3596.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A119762 |
Methyl 6-chloro-5-hydroxypyridine-3-carboxylate (CAS 915107-30-1) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 6-chloro-5-hydroxypyridine-3-carboxylate. InChIKey: ZDIHYBCAMKQMID-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | methyl 6-chloro-5-hydroxypyridine-3-carboxylate |
| InChIKey | ZDIHYBCAMKQMID-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)O |
Computed by PubChem (NCBI)