cas: 286836-79-1 — see every product listed under this CAS number, including other names
Methyl 7-bromo-1-benzofuran-5-carboxylate 97% (CAS 286836-79-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A280010-100mg |
| cas | 286836-79-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1588.56 Pln | |
| Ambeed | 5g | 6567.00 Pln | |
| Ambeed | 10g | 11512.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A280010 |
Methyl 7-bromo-1-benzofuran-5-carboxylate (CAS 286836-79-1) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: methyl 7-bromo-1-benzofuran-5-carboxylate. InChIKey: QQFMMIJEJMQKOY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | methyl 7-bromo-1-benzofuran-5-carboxylate |
| InChIKey | QQFMMIJEJMQKOY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C(=C1)C=CO2)Br |
Computed by PubChem (NCBI)