cas: 495407-02-8 — see every product listed under this CAS number, including other names
Methyl 8-Bromo-4-hydroxyquinoline-2-carboxylate, ≥95%, ≥95% (CAS 495407-02-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DK5C-1g |
| cas | 495407-02-8 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1955.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 8-bromo-4-oxo-1H-quinoline-2-carboxylate (CAS 495407-02-8) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 8-bromo-4-oxo-1H-quinoline-2-carboxylate. InChIKey: MSNCAHIJLBCEDO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 8-bromo-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | MSNCAHIJLBCEDO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C(=CC=C2)Br |
Computed by PubChem (NCBI)