cas: 52506-21-5 — see every product listed under this CAS number, including other names
Methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate 96% (CAS 52506-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A599742-250mg |
| cas | 52506-21-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1227.00 Pln | |
| Ambeed | 5g | 3563.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A599742 |
Methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate (CAS 52506-21-5) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate. InChIKey: HDBHPQJOSZBECI-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| InChIKey | HDBHPQJOSZBECI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(CCC1=O)OCCO2 |
Computed by PubChem (NCBI)