cas: 52506-21-5 — see every product listed under this CAS number, including other names
Methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate, 97%, 97% (CAS 52506-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DL33-100mg |
| cas | 52506-21-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2920.40 Pln | |
| Chemat | 10g | 5166.80 Pln | |
| Chemat | 500mg | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate (CAS 52506-21-5) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate. InChIKey: HDBHPQJOSZBECI-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | methyl 8-oxo-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| InChIKey | HDBHPQJOSZBECI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2(CCC1=O)OCCO2 |
Computed by PubChem (NCBI)