CAS 54621-94-2 appears in our catalog under these names: 3,4-Di-o-acetyl-l-fucal, 95%, 3,4-Di-o-acetyl-2,6-anhydro-1,5-dideoxy-l-arabino-hex-5-enitol, 95%, 3,4–Di–O–acetyl–L–fucal, 3,4-Di-O-acetyl-L-fucal, 95.00%, 3,4-Di-O-acetyl-L-fucal. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 2g, 500mg, 5g, 2000mg, 1000mg.
[(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate (CAS 54621-94-2) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate. InChIKey: NDEGMKQAZZBNBB-JMOVZRAMSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| InChIKey | NDEGMKQAZZBNBB-JMOVZRAMSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)