cas: 495-85-2 — see every product listed under this CAS number, including other names
Methylsticin, 98%, 98% (CAS 495-85-2) is a chemical reagent available from Chemat. Available pack sizes: 20mg, 1mg, 5mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DA5R-20mg |
| cas | 495-85-2 |
| size | 20mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 20mg | 1610.00 Pln | |
| Chemat | 1mg | 424.40 Pln | |
| Chemat | 5mg | 1005.20 Pln | |
| Chemat | 100mg | 4787.60 Pln | |
| Chemat | 200mg | 8392.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methysticin is an aromatic ether and a member of 2-pyranones.
Source: ChEBI
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | (2R)-2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one |
| InChIKey | GTEXBOVBADJOQH-FWEMWIAWSA-N |
| SMILES | COC1=CC(=O)O[C@H](C1)/C=C/C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)