CAS 9000-38-8 is the registry number for Kavakavaresin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5kg, 1kg.
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one (CAS 9000-38-8) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one. InChIKey: GTEXBOVBADJOQH-DUXPYHPUSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one |
| InChIKey | GTEXBOVBADJOQH-DUXPYHPUSA-N |
| SMILES | COC1=CC(=O)OC(C1)/C=C/C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)