Products 9000-38-8

CAS 9000-38-8 is the registry number for Kavakavaresin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5kg, 1kg.

Structural formula: {0} (CAS {1})

2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one (CAS 9000-38-8) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one. InChIKey: GTEXBOVBADJOQH-DUXPYHPUSA-N.

Identity
Molecular formulaC15H14O5
Molecular weight274.27 g/mol
IUPAC name2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-4-methoxy-2,3-dihydropyran-6-one
InChIKeyGTEXBOVBADJOQH-DUXPYHPUSA-N
SMILESCOC1=CC(=O)OC(C1)/C=C/C2=CC3=C(C=C2)OCO3

Computed by PubChem (NCBI)