CAS 120205-48-3 appears in our catalog under these names: (3R,4S,5S)-3-Methoxy-5-methyl-4-(methylamino)heptanoic Acid 1,1-Dimethylethyl Ester Hydrochloride, (3R,4S,5S)–tert–Butyl 3–methoxy–5–methyl–4–(methylamino)heptanoate hydrochloride, Monomethyl auristatin E intermediate–1, (3R,4S,5S)-tert-Butyl 3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, 98%, 98%, Monomethyl auristatin E intermediate-1, 99.95%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, 5g, 10mM (in 1ml dmso), 10g, 25g, 50g.
Tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride (CAS 120205-48-3) is a chemical compound with the molecular formula C14H30ClNO3 and a molecular weight of 295.84 g/mol. IUPAC name: tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride. InChIKey: JRXGCIIOQALIMZ-LWEGJDAASA-N.
| Molecular formula | C14H30ClNO3 |
|---|---|
| Molecular weight | 295.84 g/mol |
| IUPAC name | tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride |
| InChIKey | JRXGCIIOQALIMZ-LWEGJDAASA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)NC.Cl |
Computed by PubChem (NCBI)